1-[(3-chlorophenyl)methyl]-2-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-indole
Chemical Structure Depiction of
1-[(3-chlorophenyl)methyl]-2-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-indole
1-[(3-chlorophenyl)methyl]-2-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-indole
Compound characteristics
| Compound ID: | F356-0118 |
| Compound Name: | 1-[(3-chlorophenyl)methyl]-2-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-indole |
| Molecular Weight: | 323.78 |
| Molecular Formula: | C18 H14 Cl N3 O |
| Smiles: | Cc1nnc(c2cc3ccccc3n2Cc2cccc(c2)[Cl])o1 |
| Stereo: | ACHIRAL |
| logP: | 4.3785 |
| logD: | 4.3785 |
| logSw: | -4.3568 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 30.436 |
| InChI Key: | HBFPNFSSSQJNEL-UHFFFAOYSA-N |