2-[5-(propan-2-yl)-1,3,4-oxadiazol-2-yl]-1-{[3-(trifluoromethyl)phenyl]methyl}-1H-indole
Chemical Structure Depiction of
2-[5-(propan-2-yl)-1,3,4-oxadiazol-2-yl]-1-{[3-(trifluoromethyl)phenyl]methyl}-1H-indole
2-[5-(propan-2-yl)-1,3,4-oxadiazol-2-yl]-1-{[3-(trifluoromethyl)phenyl]methyl}-1H-indole
Compound characteristics
| Compound ID: | F356-0490 |
| Compound Name: | 2-[5-(propan-2-yl)-1,3,4-oxadiazol-2-yl]-1-{[3-(trifluoromethyl)phenyl]methyl}-1H-indole |
| Molecular Weight: | 385.39 |
| Molecular Formula: | C21 H18 F3 N3 O |
| Smiles: | CC(C)c1nnc(c2cc3ccccc3n2Cc2cccc(c2)C(F)(F)F)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.6606 |
| logD: | 5.6606 |
| logSw: | -6.3525 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 31.2081 |
| InChI Key: | COBCGLWADXOQRI-UHFFFAOYSA-N |