N-[4-({4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1H-imidazol-1-yl}methyl)phenyl]-2,5-dimethylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-[4-({4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1H-imidazol-1-yl}methyl)phenyl]-2,5-dimethylbenzene-1-sulfonamide
N-[4-({4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1H-imidazol-1-yl}methyl)phenyl]-2,5-dimethylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | F359-0070 |
| Compound Name: | N-[4-({4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1H-imidazol-1-yl}methyl)phenyl]-2,5-dimethylbenzene-1-sulfonamide |
| Molecular Weight: | 503.55 |
| Molecular Formula: | C26 H22 F N5 O3 S |
| Smiles: | Cc1ccc(C)c(c1)S(Nc1ccc(Cn2cc(c3nc(c4ccc(cc4)F)no3)nc2)cc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5979 |
| logD: | 5.4976 |
| logSw: | -5.3577 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 84.357 |
| InChI Key: | BBMFUAANOQXVKA-UHFFFAOYSA-N |