N-(3-methylbutyl)-1-{6-[(4-methylphenyl)sulfanyl]pyridazin-3-yl}piperidine-4-carboxamide
Chemical Structure Depiction of
N-(3-methylbutyl)-1-{6-[(4-methylphenyl)sulfanyl]pyridazin-3-yl}piperidine-4-carboxamide
N-(3-methylbutyl)-1-{6-[(4-methylphenyl)sulfanyl]pyridazin-3-yl}piperidine-4-carboxamide
Compound characteristics
| Compound ID: | F362-0097 |
| Compound Name: | N-(3-methylbutyl)-1-{6-[(4-methylphenyl)sulfanyl]pyridazin-3-yl}piperidine-4-carboxamide |
| Molecular Weight: | 398.57 |
| Molecular Formula: | C22 H30 N4 O S |
| Smiles: | CC(C)CCNC(C1CCN(CC1)c1ccc(nn1)Sc1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8822 |
| logD: | 4.8821 |
| logSw: | -4.3656 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.513 |
| InChI Key: | HVRMQJZHEGPHBU-UHFFFAOYSA-N |