4-[(4-chlorophenyl)methyl]-3-(2,4-dichlorophenyl)-1-sulfanylidene-1H-[1,3]thiazolo[3,4-a]quinazolin-5(4H)-one
Chemical Structure Depiction of
4-[(4-chlorophenyl)methyl]-3-(2,4-dichlorophenyl)-1-sulfanylidene-1H-[1,3]thiazolo[3,4-a]quinazolin-5(4H)-one
4-[(4-chlorophenyl)methyl]-3-(2,4-dichlorophenyl)-1-sulfanylidene-1H-[1,3]thiazolo[3,4-a]quinazolin-5(4H)-one
Compound characteristics
| Compound ID: | F369-0068 |
| Compound Name: | 4-[(4-chlorophenyl)methyl]-3-(2,4-dichlorophenyl)-1-sulfanylidene-1H-[1,3]thiazolo[3,4-a]quinazolin-5(4H)-one |
| Molecular Weight: | 503.85 |
| Molecular Formula: | C23 H13 Cl3 N2 O S2 |
| Smiles: | C(c1ccc(cc1)[Cl])N1C2=C(c3ccc(cc3[Cl])[Cl])SC(N2c2ccccc2C1=O)=S |
| Stereo: | ACHIRAL |
| logP: | 7.3012 |
| logD: | 7.3012 |
| logSw: | -6.6265 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 17.788 |
| InChI Key: | PKBCGOJISPZOGM-UHFFFAOYSA-N |