5-[(4-chlorophenyl)methyl]-3-[4-(pyrrolidin-1-yl)phenyl]-1,2,4-oxadiazole
Chemical Structure Depiction of
5-[(4-chlorophenyl)methyl]-3-[4-(pyrrolidin-1-yl)phenyl]-1,2,4-oxadiazole
5-[(4-chlorophenyl)methyl]-3-[4-(pyrrolidin-1-yl)phenyl]-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | F373-0082 |
| Compound Name: | 5-[(4-chlorophenyl)methyl]-3-[4-(pyrrolidin-1-yl)phenyl]-1,2,4-oxadiazole |
| Molecular Weight: | 339.82 |
| Molecular Formula: | C19 H18 Cl N3 O |
| Smiles: | C1CCN(C1)c1ccc(cc1)c1nc(Cc2ccc(cc2)[Cl])on1 |
| Stereo: | ACHIRAL |
| logP: | 5.5737 |
| logD: | 5.5737 |
| logSw: | -6.2555 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 35.128 |
| InChI Key: | NXRZNRCXGFCQKQ-UHFFFAOYSA-N |