1-(4-{5-[(4-methoxyphenoxy)methyl]-1,2,4-oxadiazol-3-yl}phenyl)-4-methylpiperidine
Chemical Structure Depiction of
1-(4-{5-[(4-methoxyphenoxy)methyl]-1,2,4-oxadiazol-3-yl}phenyl)-4-methylpiperidine
1-(4-{5-[(4-methoxyphenoxy)methyl]-1,2,4-oxadiazol-3-yl}phenyl)-4-methylpiperidine
Compound characteristics
| Compound ID: | F373-0430 |
| Compound Name: | 1-(4-{5-[(4-methoxyphenoxy)methyl]-1,2,4-oxadiazol-3-yl}phenyl)-4-methylpiperidine |
| Molecular Weight: | 379.46 |
| Molecular Formula: | C22 H25 N3 O3 |
| Smiles: | CC1CCN(CC1)c1ccc(cc1)c1nc(COc2ccc(cc2)OC)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.1979 |
| logD: | 5.1979 |
| logSw: | -5.2253 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 49.805 |
| InChI Key: | SFKZNYPZQSUJDE-UHFFFAOYSA-N |