1-(4-{5-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}phenyl)-4-methylpiperidine
Chemical Structure Depiction of
1-(4-{5-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}phenyl)-4-methylpiperidine
1-(4-{5-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}phenyl)-4-methylpiperidine
Compound characteristics
| Compound ID: | F373-0431 |
| Compound Name: | 1-(4-{5-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}phenyl)-4-methylpiperidine |
| Molecular Weight: | 367.42 |
| Molecular Formula: | C21 H22 F N3 O2 |
| Smiles: | CC1CCN(CC1)c1ccc(cc1)c1nc(COc2ccc(cc2)F)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.2446 |
| logD: | 5.2446 |
| logSw: | -5.215 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 42.261 |
| InChI Key: | BKPVPJGUELBFSY-UHFFFAOYSA-N |