ethyl 4-[(4-fluoro-2-methylphenyl)sulfamoyl]-1,3,5-trimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 4-[(4-fluoro-2-methylphenyl)sulfamoyl]-1,3,5-trimethyl-1H-pyrrole-2-carboxylate
ethyl 4-[(4-fluoro-2-methylphenyl)sulfamoyl]-1,3,5-trimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | F378-0574 |
| Compound Name: | ethyl 4-[(4-fluoro-2-methylphenyl)sulfamoyl]-1,3,5-trimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 368.43 |
| Molecular Formula: | C17 H21 F N2 O4 S |
| Smiles: | CCOC(c1c(C)c(c(C)n1C)S(Nc1ccc(cc1C)F)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8135 |
| logD: | 1.8846 |
| logSw: | -3.2803 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.752 |
| InChI Key: | VXSBIDVVQCKCHY-UHFFFAOYSA-N |