ethyl 4-[(2-methoxy-5-methylphenyl)sulfamoyl]-1,3,5-trimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 4-[(2-methoxy-5-methylphenyl)sulfamoyl]-1,3,5-trimethyl-1H-pyrrole-2-carboxylate
ethyl 4-[(2-methoxy-5-methylphenyl)sulfamoyl]-1,3,5-trimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | F378-0577 |
| Compound Name: | ethyl 4-[(2-methoxy-5-methylphenyl)sulfamoyl]-1,3,5-trimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 380.46 |
| Molecular Formula: | C18 H24 N2 O5 S |
| Smiles: | CCOC(c1c(C)c(c(C)n1C)S(Nc1cc(C)ccc1OC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5574 |
| logD: | 2.2015 |
| logSw: | -3.0158 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.383 |
| InChI Key: | UZTMIOIGEOWOOX-UHFFFAOYSA-N |