3,5-dimethyl-N-[(3-methylphenyl)methyl]-4-(pyrrolidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
Chemical Structure Depiction of
3,5-dimethyl-N-[(3-methylphenyl)methyl]-4-(pyrrolidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
3,5-dimethyl-N-[(3-methylphenyl)methyl]-4-(pyrrolidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
Compound characteristics
| Compound ID: | F379-0343 |
| Compound Name: | 3,5-dimethyl-N-[(3-methylphenyl)methyl]-4-(pyrrolidine-1-sulfonyl)-1H-pyrrole-2-carboxamide |
| Molecular Weight: | 375.49 |
| Molecular Formula: | C19 H25 N3 O3 S |
| Smiles: | Cc1cccc(CNC(c2c(C)c(c(C)[nH]2)S(N2CCCC2)(=O)=O)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 2.8179 |
| logD: | 2.8178 |
| logSw: | -3.3618 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.71 |
| InChI Key: | XMIMHYDPHZETLW-UHFFFAOYSA-N |