N-(4-chlorophenyl)-3,5-dimethyl-4-(morpholine-4-sulfonyl)-1H-pyrrole-2-carboxamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-3,5-dimethyl-4-(morpholine-4-sulfonyl)-1H-pyrrole-2-carboxamide
N-(4-chlorophenyl)-3,5-dimethyl-4-(morpholine-4-sulfonyl)-1H-pyrrole-2-carboxamide
Compound characteristics
| Compound ID: | F379-1210 |
| Compound Name: | N-(4-chlorophenyl)-3,5-dimethyl-4-(morpholine-4-sulfonyl)-1H-pyrrole-2-carboxamide |
| Molecular Weight: | 397.88 |
| Molecular Formula: | C17 H20 Cl N3 O4 S |
| Smiles: | Cc1c(c(C)[nH]c1C(Nc1ccc(cc1)[Cl])=O)S(N1CCOCC1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3898 |
| logD: | 2.3797 |
| logSw: | -3.3105 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.931 |
| InChI Key: | LRBGXLSSBCTMPC-UHFFFAOYSA-N |