[4-(azepane-1-sulfonyl)-3,5-dimethyl-1H-pyrrol-2-yl][3-methyl-4-(3-methylphenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
[4-(azepane-1-sulfonyl)-3,5-dimethyl-1H-pyrrol-2-yl][3-methyl-4-(3-methylphenyl)piperazin-1-yl]methanone
[4-(azepane-1-sulfonyl)-3,5-dimethyl-1H-pyrrol-2-yl][3-methyl-4-(3-methylphenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | F379-1667 |
| Compound Name: | [4-(azepane-1-sulfonyl)-3,5-dimethyl-1H-pyrrol-2-yl][3-methyl-4-(3-methylphenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 472.65 |
| Molecular Formula: | C25 H36 N4 O3 S |
| Smiles: | CC1CN(CCN1c1cccc(C)c1)C(c1c(C)c(c(C)[nH]1)S(N1CCCCCC1)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9473 |
| logD: | 3.9473 |
| logSw: | -3.8295 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.389 |
| InChI Key: | CQWXHGHYFNJRDS-IBGZPJMESA-N |