3-[5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxybenzene-1-sulfonyl]-N-(3,4-dimethylphenyl)propanamide
Chemical Structure Depiction of
3-[5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxybenzene-1-sulfonyl]-N-(3,4-dimethylphenyl)propanamide
3-[5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxybenzene-1-sulfonyl]-N-(3,4-dimethylphenyl)propanamide
Compound characteristics
| Compound ID: | F382-1286 |
| Compound Name: | 3-[5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxybenzene-1-sulfonyl]-N-(3,4-dimethylphenyl)propanamide |
| Molecular Weight: | 442.53 |
| Molecular Formula: | C23 H26 N2 O5 S |
| Smiles: | Cc1ccc(cc1C)NC(CCS(c1cc(ccc1OC)c1c(C)c(C)no1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.357 |
| logD: | 4.357 |
| logSw: | -4.2755 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.128 |
| InChI Key: | PWXQGXFOJFKIPC-UHFFFAOYSA-N |