5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-N-(3-ethylphenyl)-2-methylbenzene-1-sulfonamide
					Chemical Structure Depiction of
5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-N-(3-ethylphenyl)-2-methylbenzene-1-sulfonamide
			5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-N-(3-ethylphenyl)-2-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | F383-0143 | 
| Compound Name: | 5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-N-(3-ethylphenyl)-2-methylbenzene-1-sulfonamide | 
| Molecular Weight: | 440.56 | 
| Molecular Formula: | C24 H28 N2 O4 S | 
| Smiles: | CCc1cccc(c1)NS(c1cc(CN2C(C3CCCCC3C2=O)=O)ccc1C)(=O)=O | 
| Stereo: | MIXTURE OF STEREOISOMERS | 
| logP: | 4.4104 | 
| logD: | 4.3598 | 
| logSw: | -4.3045 | 
| Hydrogen bond acceptors count: | 8 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 70.333 | 
| InChI Key: | KPPCPELEIPCDSW-UHFFFAOYSA-N | 
 
				 
				