5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-2-methyl-N-[4-(trifluoromethyl)phenyl]benzene-1-sulfonamide
Chemical Structure Depiction of
5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-2-methyl-N-[4-(trifluoromethyl)phenyl]benzene-1-sulfonamide
5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-2-methyl-N-[4-(trifluoromethyl)phenyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | F383-0157 |
| Compound Name: | 5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-2-methyl-N-[4-(trifluoromethyl)phenyl]benzene-1-sulfonamide |
| Molecular Weight: | 480.5 |
| Molecular Formula: | C23 H23 F3 N2 O4 S |
| Smiles: | Cc1ccc(CN2C(C3CCCCC3C2=O)=O)cc1S(Nc1ccc(cc1)C(F)(F)F)(=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.5257 |
| logD: | 4.4255 |
| logSw: | -4.2939 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.333 |
| InChI Key: | GDGYOOYMVHVHBH-UHFFFAOYSA-N |