N-cycloheptyl-5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-2-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
N-cycloheptyl-5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-2-methoxybenzene-1-sulfonamide
N-cycloheptyl-5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-2-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | F383-0819 |
| Compound Name: | N-cycloheptyl-5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-2-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 448.58 |
| Molecular Formula: | C23 H32 N2 O5 S |
| Smiles: | COc1ccc(CN2C(C3CCCCC3C2=O)=O)cc1S(NC1CCCCCC1)(=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.7143 |
| logD: | 3.7143 |
| logSw: | -3.9468 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.342 |
| InChI Key: | JOSFWTXTVTWDJO-UHFFFAOYSA-N |