2-{[4-methoxy-3-(2-methylpiperidine-1-sulfonyl)phenyl]methyl}hexahydro-1H-isoindole-1,3(2H)-dione
Chemical Structure Depiction of
2-{[4-methoxy-3-(2-methylpiperidine-1-sulfonyl)phenyl]methyl}hexahydro-1H-isoindole-1,3(2H)-dione
2-{[4-methoxy-3-(2-methylpiperidine-1-sulfonyl)phenyl]methyl}hexahydro-1H-isoindole-1,3(2H)-dione
Compound characteristics
| Compound ID: | F383-0850 |
| Compound Name: | 2-{[4-methoxy-3-(2-methylpiperidine-1-sulfonyl)phenyl]methyl}hexahydro-1H-isoindole-1,3(2H)-dione |
| Molecular Weight: | 434.55 |
| Molecular Formula: | C22 H30 N2 O5 S |
| Smiles: | CC1CCCCN1S(c1cc(CN2C(C3CCCCC3C2=O)=O)ccc1OC)(=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.7711 |
| logD: | 2.7711 |
| logSw: | -3.1602 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 69.087 |
| InChI Key: | ONHBYYSYPHMWFV-UHFFFAOYSA-N |