5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-2-methoxy-N-(2-methylphenyl)benzene-1-sulfonamide
Chemical Structure Depiction of
5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-2-methoxy-N-(2-methylphenyl)benzene-1-sulfonamide
5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-2-methoxy-N-(2-methylphenyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | F383-0868 |
| Compound Name: | 5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-2-methoxy-N-(2-methylphenyl)benzene-1-sulfonamide |
| Molecular Weight: | 442.53 |
| Molecular Formula: | C23 H26 N2 O5 S |
| Smiles: | Cc1ccccc1NS(c1cc(CN2C(C3CCCCC3C2=O)=O)ccc1OC)(=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.1193 |
| logD: | 3.0909 |
| logSw: | -3.4044 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.266 |
| InChI Key: | HBODZVCWNZETEW-UHFFFAOYSA-N |