N-benzyl-5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-N-ethyl-2-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
N-benzyl-5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-N-ethyl-2-methoxybenzene-1-sulfonamide
N-benzyl-5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-N-ethyl-2-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | F383-0966 |
| Compound Name: | N-benzyl-5-[(1,3-dioxooctahydro-2H-isoindol-2-yl)methyl]-N-ethyl-2-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 470.59 |
| Molecular Formula: | C25 H30 N2 O5 S |
| Smiles: | CCN(Cc1ccccc1)S(c1cc(CN2C(C3CCCCC3C2=O)=O)ccc1OC)(=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.4949 |
| logD: | 3.4949 |
| logSw: | -3.7371 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 68.414 |
| InChI Key: | GMERRXXLPAQBKR-UHFFFAOYSA-N |