N,1-dimethyl-N-(2-{[(4-methylphenyl)methyl]amino}-2-oxoethyl)-1H-benzotriazole-5-carboxamide
Chemical Structure Depiction of
N,1-dimethyl-N-(2-{[(4-methylphenyl)methyl]amino}-2-oxoethyl)-1H-benzotriazole-5-carboxamide
N,1-dimethyl-N-(2-{[(4-methylphenyl)methyl]amino}-2-oxoethyl)-1H-benzotriazole-5-carboxamide
Compound characteristics
| Compound ID: | F385-0069 |
| Compound Name: | N,1-dimethyl-N-(2-{[(4-methylphenyl)methyl]amino}-2-oxoethyl)-1H-benzotriazole-5-carboxamide |
| Molecular Weight: | 351.41 |
| Molecular Formula: | C19 H21 N5 O2 |
| Smiles: | Cc1ccc(CNC(CN(C)C(c2ccc3c(c2)nnn3C)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 1.1832 |
| logD: | 1.1832 |
| logSw: | -2.2506 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.844 |
| InChI Key: | FCROVZBMXKHDJQ-UHFFFAOYSA-N |