1-cyclopentyl-N-[2-(2,4-difluoroanilino)-2-oxoethyl]-N-methyl-1H-benzotriazole-5-carboxamide
Chemical Structure Depiction of
1-cyclopentyl-N-[2-(2,4-difluoroanilino)-2-oxoethyl]-N-methyl-1H-benzotriazole-5-carboxamide
1-cyclopentyl-N-[2-(2,4-difluoroanilino)-2-oxoethyl]-N-methyl-1H-benzotriazole-5-carboxamide
Compound characteristics
| Compound ID: | F385-1223 |
| Compound Name: | 1-cyclopentyl-N-[2-(2,4-difluoroanilino)-2-oxoethyl]-N-methyl-1H-benzotriazole-5-carboxamide |
| Molecular Weight: | 413.43 |
| Molecular Formula: | C21 H21 F2 N5 O2 |
| Smiles: | CN(CC(Nc1ccc(cc1F)F)=O)C(c1ccc2c(c1)nnn2C1CCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5286 |
| logD: | 2.52 |
| logSw: | -2.9885 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.602 |
| InChI Key: | SVDJWKJVWJLCSP-UHFFFAOYSA-N |