N-(4-chloro-2-fluorophenyl)-2-{3-[(2-chlorophenyl)methyl]-4-oxo-3,4-dihydro-5H-pyrimido[5,4-b]indol-5-yl}acetamide
Chemical Structure Depiction of
N-(4-chloro-2-fluorophenyl)-2-{3-[(2-chlorophenyl)methyl]-4-oxo-3,4-dihydro-5H-pyrimido[5,4-b]indol-5-yl}acetamide
N-(4-chloro-2-fluorophenyl)-2-{3-[(2-chlorophenyl)methyl]-4-oxo-3,4-dihydro-5H-pyrimido[5,4-b]indol-5-yl}acetamide
Compound characteristics
| Compound ID: | F394-0167 |
| Compound Name: | N-(4-chloro-2-fluorophenyl)-2-{3-[(2-chlorophenyl)methyl]-4-oxo-3,4-dihydro-5H-pyrimido[5,4-b]indol-5-yl}acetamide |
| Molecular Weight: | 495.34 |
| Molecular Formula: | C25 H17 Cl2 F N4 O2 |
| Smiles: | [H]c1ccc2c(c1)c1c(C(N(Cc3ccccc3[Cl])C=N1)=O)n2CC(Nc1ccc(cc1F)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.3973 |
| logD: | 5.3756 |
| logSw: | -5.9601 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.38 |
| InChI Key: | GIEWSHFXCCMDQB-UHFFFAOYSA-N |