2-{[2-(2-chlorophenyl)-2-oxoethyl]sulfanyl}-3-(2-phenylpropyl)pyrido[3',2':4,5]thieno[3,2-d]pyrimidin-4(3H)-one
Chemical Structure Depiction of
2-{[2-(2-chlorophenyl)-2-oxoethyl]sulfanyl}-3-(2-phenylpropyl)pyrido[3',2':4,5]thieno[3,2-d]pyrimidin-4(3H)-one
2-{[2-(2-chlorophenyl)-2-oxoethyl]sulfanyl}-3-(2-phenylpropyl)pyrido[3',2':4,5]thieno[3,2-d]pyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | F399-0697 |
| Compound Name: | 2-{[2-(2-chlorophenyl)-2-oxoethyl]sulfanyl}-3-(2-phenylpropyl)pyrido[3',2':4,5]thieno[3,2-d]pyrimidin-4(3H)-one |
| Molecular Weight: | 506.04 |
| Molecular Formula: | C26 H20 Cl N3 O2 S2 |
| Smiles: | CC(CN1C(=Nc2c3cccnc3sc2C1=O)SCC(c1ccccc1[Cl])=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.2879 |
| logD: | 6.2879 |
| logSw: | -5.9843 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 46.918 |
| InChI Key: | CLYHXUJDEZPZOD-INIZCTEOSA-N |