3-[(3-methoxyphenyl)methyl]-5-[(3-methylphenyl)methyl]-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
Chemical Structure Depiction of
3-[(3-methoxyphenyl)methyl]-5-[(3-methylphenyl)methyl]-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
3-[(3-methoxyphenyl)methyl]-5-[(3-methylphenyl)methyl]-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
Compound characteristics
| Compound ID: | F400-0191 |
| Compound Name: | 3-[(3-methoxyphenyl)methyl]-5-[(3-methylphenyl)methyl]-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one |
| Molecular Weight: | 409.49 |
| Molecular Formula: | C26 H23 N3 O2 |
| Smiles: | [H]c1ccc2c(c1)c1c(C(N(Cc3cccc(c3)OC)C=N1)=O)n2Cc1cccc(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.0718 |
| logD: | 5.0718 |
| logSw: | -5.0664 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.472 |
| InChI Key: | YHYNQFYHVAGHMW-UHFFFAOYSA-N |