8-fluoro-5-[(4-fluorophenyl)methyl]-3-[(3-methoxyphenyl)methyl]-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
Chemical Structure Depiction of
8-fluoro-5-[(4-fluorophenyl)methyl]-3-[(3-methoxyphenyl)methyl]-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
8-fluoro-5-[(4-fluorophenyl)methyl]-3-[(3-methoxyphenyl)methyl]-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
Compound characteristics
| Compound ID: | F400-0448 |
| Compound Name: | 8-fluoro-5-[(4-fluorophenyl)methyl]-3-[(3-methoxyphenyl)methyl]-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one |
| Molecular Weight: | 431.44 |
| Molecular Formula: | C25 H19 F2 N3 O2 |
| Smiles: | COc1cccc(CN2C=Nc3c4cc(ccc4n(Cc4ccc(cc4)F)c3C2=O)F)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.6346 |
| logD: | 4.6346 |
| logSw: | -4.6377 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.472 |
| InChI Key: | DYMVWTCRHVLSQY-UHFFFAOYSA-N |