N-(2-methoxyphenyl)-2-[2-oxo-4-(thiophen-2-yl)-2,3-dihydro-1H-1,5-benzodiazepin-1-yl]acetamide
Chemical Structure Depiction of
N-(2-methoxyphenyl)-2-[2-oxo-4-(thiophen-2-yl)-2,3-dihydro-1H-1,5-benzodiazepin-1-yl]acetamide
N-(2-methoxyphenyl)-2-[2-oxo-4-(thiophen-2-yl)-2,3-dihydro-1H-1,5-benzodiazepin-1-yl]acetamide
Compound characteristics
| Compound ID: | F402-0018 |
| Compound Name: | N-(2-methoxyphenyl)-2-[2-oxo-4-(thiophen-2-yl)-2,3-dihydro-1H-1,5-benzodiazepin-1-yl]acetamide |
| Molecular Weight: | 405.47 |
| Molecular Formula: | C22 H19 N3 O3 S |
| Smiles: | COc1ccccc1NC(CN1C(CC(c2cccs2)=Nc2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6408 |
| logD: | 3.6407 |
| logSw: | -4.0031 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.69 |
| InChI Key: | JTRWXKPJZIIXDZ-UHFFFAOYSA-N |