2-[7,8-dimethyl-2-oxo-4-(thiophen-2-yl)-2,3-dihydro-1H-1,5-benzodiazepin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide
Chemical Structure Depiction of
2-[7,8-dimethyl-2-oxo-4-(thiophen-2-yl)-2,3-dihydro-1H-1,5-benzodiazepin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide
2-[7,8-dimethyl-2-oxo-4-(thiophen-2-yl)-2,3-dihydro-1H-1,5-benzodiazepin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide
Compound characteristics
| Compound ID: | F402-0413 |
| Compound Name: | 2-[7,8-dimethyl-2-oxo-4-(thiophen-2-yl)-2,3-dihydro-1H-1,5-benzodiazepin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| Molecular Weight: | 471.5 |
| Molecular Formula: | C24 H20 F3 N3 O2 S |
| Smiles: | Cc1cc2c(cc1C)N(CC(Nc1cccc(c1)C(F)(F)F)=O)C(CC(c1cccs1)=N2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8684 |
| logD: | 5.8675 |
| logSw: | -5.6313 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.758 |
| InChI Key: | WLZUSOYTFNPJRV-UHFFFAOYSA-N |