5-ethyl-2-({[2-(2-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}sulfanyl)-6-methylpyrimidin-4-ol
Chemical Structure Depiction of
5-ethyl-2-({[2-(2-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}sulfanyl)-6-methylpyrimidin-4-ol
5-ethyl-2-({[2-(2-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}sulfanyl)-6-methylpyrimidin-4-ol
Compound characteristics
| Compound ID: | F407-0270 |
| Compound Name: | 5-ethyl-2-({[2-(2-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}sulfanyl)-6-methylpyrimidin-4-ol |
| Molecular Weight: | 371.46 |
| Molecular Formula: | C19 H21 N3 O3 S |
| Smiles: | CCc1c(C)nc(nc1O)SCc1c(C)oc(c2ccccc2OC)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.8296 |
| logD: | 3.7977 |
| logSw: | -4.024 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.55 |
| InChI Key: | VGKKBTGHPVXPFR-UHFFFAOYSA-N |