N-(4-bromophenyl)-5-(3-fluoroanilino)-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
N-(4-bromophenyl)-5-(3-fluoroanilino)-1H-1,2,3-triazole-4-carboxamide
N-(4-bromophenyl)-5-(3-fluoroanilino)-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | F414-0816 |
| Compound Name: | N-(4-bromophenyl)-5-(3-fluoroanilino)-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 376.19 |
| Molecular Formula: | C15 H11 Br F N5 O |
| Smiles: | c1cc(cc(c1)F)Nc1c(C(Nc2ccc(cc2)[Br])=O)nn[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 3.6909 |
| logD: | 3.625 |
| logSw: | -4.1191 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 69.555 |
| InChI Key: | DURAZYGRBSLAFI-UHFFFAOYSA-N |