N-(3-chloro-4-fluorophenyl)-3-[methyl(4-methylphenyl)sulfamoyl]thiophene-2-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-3-[methyl(4-methylphenyl)sulfamoyl]thiophene-2-carboxamide
N-(3-chloro-4-fluorophenyl)-3-[methyl(4-methylphenyl)sulfamoyl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | F420-0138 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-3-[methyl(4-methylphenyl)sulfamoyl]thiophene-2-carboxamide |
| Molecular Weight: | 438.93 |
| Molecular Formula: | C19 H16 Cl F N2 O3 S2 |
| Smiles: | Cc1ccc(cc1)N(C)S(c1ccsc1C(Nc1ccc(c(c1)[Cl])F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1332 |
| logD: | 4.703 |
| logSw: | -5.6307 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.169 |
| InChI Key: | KPPVAQFPMWFLBZ-UHFFFAOYSA-N |