ethyl 5-(4-propylpiperazine-1-sulfonyl)-1H-pyrazole-4-carboxylate
Chemical Structure Depiction of
ethyl 5-(4-propylpiperazine-1-sulfonyl)-1H-pyrazole-4-carboxylate
ethyl 5-(4-propylpiperazine-1-sulfonyl)-1H-pyrazole-4-carboxylate
Compound characteristics
| Compound ID: | F421-0136 |
| Compound Name: | ethyl 5-(4-propylpiperazine-1-sulfonyl)-1H-pyrazole-4-carboxylate |
| Molecular Weight: | 330.4 |
| Molecular Formula: | C13 H22 N4 O4 S |
| Smiles: | CCCN1CCN(CC1)S(c1c(cn[nH]1)C(=O)OCC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.0617 |
| logD: | 0.7383 |
| logSw: | -2.1051 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.73 |
| InChI Key: | GBANYKNZGVDPBJ-UHFFFAOYSA-N |