N-(4-butylphenyl)-3-[(4-ethoxyphenyl)sulfamoyl]-1H-pyrazole-5-carboxamide
Chemical Structure Depiction of
N-(4-butylphenyl)-3-[(4-ethoxyphenyl)sulfamoyl]-1H-pyrazole-5-carboxamide
N-(4-butylphenyl)-3-[(4-ethoxyphenyl)sulfamoyl]-1H-pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | F422-0008 |
| Compound Name: | N-(4-butylphenyl)-3-[(4-ethoxyphenyl)sulfamoyl]-1H-pyrazole-5-carboxamide |
| Molecular Weight: | 442.54 |
| Molecular Formula: | C22 H26 N4 O4 S |
| Smiles: | CCCCc1ccc(cc1)NC(c1cc(n[nH]1)S(Nc1ccc(cc1)OCC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3902 |
| logD: | 5.388 |
| logSw: | -5.2509 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 93.639 |
| InChI Key: | ANOYSUSFBFQCDE-UHFFFAOYSA-N |