N-methyl-4-(4-methylphenyl)-3-(1H-pyrrol-1-yl)thiophene-2-carboxamide
Chemical Structure Depiction of
N-methyl-4-(4-methylphenyl)-3-(1H-pyrrol-1-yl)thiophene-2-carboxamide
N-methyl-4-(4-methylphenyl)-3-(1H-pyrrol-1-yl)thiophene-2-carboxamide
Compound characteristics
| Compound ID: | F423-0326 |
| Compound Name: | N-methyl-4-(4-methylphenyl)-3-(1H-pyrrol-1-yl)thiophene-2-carboxamide |
| Molecular Weight: | 296.39 |
| Molecular Formula: | C17 H16 N2 O S |
| Smiles: | Cc1ccc(cc1)c1csc(C(NC)=O)c1n1cccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.0988 |
| logD: | 4.0988 |
| logSw: | -4.3018 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.2045 |
| InChI Key: | XFMXIPUNIUIPSG-UHFFFAOYSA-N |