3-(2-methylpropyl)-2-[({3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)sulfanyl]thieno[3,2-d]pyrimidin-4(3H)-one
Chemical Structure Depiction of
3-(2-methylpropyl)-2-[({3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)sulfanyl]thieno[3,2-d]pyrimidin-4(3H)-one
3-(2-methylpropyl)-2-[({3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)sulfanyl]thieno[3,2-d]pyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | F425-0372 |
| Compound Name: | 3-(2-methylpropyl)-2-[({3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)sulfanyl]thieno[3,2-d]pyrimidin-4(3H)-one |
| Molecular Weight: | 466.5 |
| Molecular Formula: | C20 H17 F3 N4 O2 S2 |
| Smiles: | CC(C)CN1C(=Nc2ccsc2C1=O)SCc1nc(c2ccc(cc2)C(F)(F)F)no1 |
| Stereo: | ACHIRAL |
| logP: | 6.0475 |
| logD: | 6.0475 |
| logSw: | -5.5027 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 58.404 |
| InChI Key: | WOEVEEVGVCYQTG-UHFFFAOYSA-N |