3-chloro-N-{N'-(3,4-dimethylphenyl)-N-[(pyridin-4-yl)methyl]carbamimidoyl}-4-fluorobenzamide
Chemical Structure Depiction of
3-chloro-N-{N'-(3,4-dimethylphenyl)-N-[(pyridin-4-yl)methyl]carbamimidoyl}-4-fluorobenzamide
3-chloro-N-{N'-(3,4-dimethylphenyl)-N-[(pyridin-4-yl)methyl]carbamimidoyl}-4-fluorobenzamide
Compound characteristics
| Compound ID: | F430-1908 |
| Compound Name: | 3-chloro-N-{N'-(3,4-dimethylphenyl)-N-[(pyridin-4-yl)methyl]carbamimidoyl}-4-fluorobenzamide |
| Molecular Weight: | 410.88 |
| Molecular Formula: | C22 H20 Cl F N4 O |
| Smiles: | Cc1ccc(cc1C)/N=C(\NCc1ccncc1)NC(c1ccc(c(c1)[Cl])F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3379 |
| logD: | 3.3322 |
| logSw: | -4.5834 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.28 |
| InChI Key: | UYKXRBIBXHPMQO-UHFFFAOYSA-N |