N-{6-[(2-chlorophenyl)sulfanyl]-1,3-dimethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl}thiophene-2-carboxamide
Chemical Structure Depiction of
N-{6-[(2-chlorophenyl)sulfanyl]-1,3-dimethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl}thiophene-2-carboxamide
N-{6-[(2-chlorophenyl)sulfanyl]-1,3-dimethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl}thiophene-2-carboxamide
Compound characteristics
| Compound ID: | F431-0569 |
| Compound Name: | N-{6-[(2-chlorophenyl)sulfanyl]-1,3-dimethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl}thiophene-2-carboxamide |
| Molecular Weight: | 429.95 |
| Molecular Formula: | C20 H16 Cl N3 O2 S2 |
| Smiles: | CN1C(N(C)c2cc(c(cc12)NC(c1cccs1)=O)Sc1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.1036 |
| logD: | 5.1036 |
| logSw: | -5.5584 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.063 |
| InChI Key: | CGIHFNZAERWOQA-UHFFFAOYSA-N |