1-phenyl-N-[3-(trifluoromethyl)phenyl]-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
1-phenyl-N-[3-(trifluoromethyl)phenyl]-1H-pyrazole-4-carboxamide
1-phenyl-N-[3-(trifluoromethyl)phenyl]-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | F434-0006 |
| Compound Name: | 1-phenyl-N-[3-(trifluoromethyl)phenyl]-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 331.29 |
| Molecular Formula: | C17 H12 F3 N3 O |
| Smiles: | c1ccc(cc1)n1cc(cn1)C(Nc1cccc(c1)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0643 |
| logD: | 4.0613 |
| logSw: | -4.2335 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.687 |
| InChI Key: | FJDGXFLTJGPGBJ-UHFFFAOYSA-N |