1-(4-fluorophenyl)-N-[2-(4-methylphenyl)ethyl]-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
1-(4-fluorophenyl)-N-[2-(4-methylphenyl)ethyl]-1H-pyrazole-4-carboxamide
1-(4-fluorophenyl)-N-[2-(4-methylphenyl)ethyl]-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | F434-0357 |
| Compound Name: | 1-(4-fluorophenyl)-N-[2-(4-methylphenyl)ethyl]-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 323.37 |
| Molecular Formula: | C19 H18 F N3 O |
| Smiles: | Cc1ccc(CCNC(c2cnn(c2)c2ccc(cc2)F)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.1945 |
| logD: | 3.1945 |
| logSw: | -3.3391 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.851 |
| InChI Key: | PFNZVUAXKHEIPV-UHFFFAOYSA-N |