N-(4-chloro-2-methylphenyl)-1-(4-chlorophenyl)-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
N-(4-chloro-2-methylphenyl)-1-(4-chlorophenyl)-1H-pyrazole-4-carboxamide
N-(4-chloro-2-methylphenyl)-1-(4-chlorophenyl)-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | F434-0571 |
| Compound Name: | N-(4-chloro-2-methylphenyl)-1-(4-chlorophenyl)-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 346.21 |
| Molecular Formula: | C17 H13 Cl2 N3 O |
| Smiles: | Cc1cc(ccc1NC(c1cnn(c1)c1ccc(cc1)[Cl])=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.7963 |
| logD: | 4.795 |
| logSw: | -4.8064 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.989 |
| InChI Key: | HOUXPKUWBUGMFG-UHFFFAOYSA-N |