1-(4-chlorophenyl)-N-(4-ethylphenyl)-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
1-(4-chlorophenyl)-N-(4-ethylphenyl)-1H-pyrazole-4-carboxamide
1-(4-chlorophenyl)-N-(4-ethylphenyl)-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | F434-0585 |
| Compound Name: | 1-(4-chlorophenyl)-N-(4-ethylphenyl)-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 325.8 |
| Molecular Formula: | C18 H16 Cl N3 O |
| Smiles: | CCc1ccc(cc1)NC(c1cnn(c1)c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.668 |
| logD: | 4.668 |
| logSw: | -4.7372 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.687 |
| InChI Key: | MDWDSQILIUOZMY-UHFFFAOYSA-N |