1-(4-bromophenyl)-N-[(4-methoxyphenyl)methyl]-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
1-(4-bromophenyl)-N-[(4-methoxyphenyl)methyl]-1H-pyrazole-4-carboxamide
1-(4-bromophenyl)-N-[(4-methoxyphenyl)methyl]-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | F434-0845 |
| Compound Name: | 1-(4-bromophenyl)-N-[(4-methoxyphenyl)methyl]-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 386.25 |
| Molecular Formula: | C18 H16 Br N3 O2 |
| Smiles: | COc1ccc(CNC(c2cnn(c2)c2ccc(cc2)[Br])=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.6248 |
| logD: | 3.6248 |
| logSw: | -3.7602 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.553 |
| InChI Key: | MEOGKTHZZOKOHX-UHFFFAOYSA-N |