1-(4-bromophenyl)-N-(5-chloro-2-methoxyphenyl)-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
1-(4-bromophenyl)-N-(5-chloro-2-methoxyphenyl)-1H-pyrazole-4-carboxamide
1-(4-bromophenyl)-N-(5-chloro-2-methoxyphenyl)-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | F434-0910 |
| Compound Name: | 1-(4-bromophenyl)-N-(5-chloro-2-methoxyphenyl)-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 406.66 |
| Molecular Formula: | C17 H13 Br Cl N3 O2 |
| Smiles: | COc1ccc(cc1NC(c1cnn(c1)c1ccc(cc1)[Br])=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.4276 |
| logD: | 4.4035 |
| logSw: | -4.5627 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.62 |
| InChI Key: | WELGYQAFUJRXHV-UHFFFAOYSA-N |