1-(4-bromophenyl)-N-(4-phenylbutan-2-yl)-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
1-(4-bromophenyl)-N-(4-phenylbutan-2-yl)-1H-pyrazole-4-carboxamide
1-(4-bromophenyl)-N-(4-phenylbutan-2-yl)-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | F434-0919 |
| Compound Name: | 1-(4-bromophenyl)-N-(4-phenylbutan-2-yl)-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 398.3 |
| Molecular Formula: | C20 H20 Br N3 O |
| Smiles: | CC(CCc1ccccc1)NC(c1cnn(c1)c1ccc(cc1)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4006 |
| logD: | 4.4006 |
| logSw: | -4.2168 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.451 |
| InChI Key: | IFVDEJNEAFRUFA-HNNXBMFYSA-N |