1-(4-bromophenyl)-N-[(2,4-dimethoxyphenyl)methyl]-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
1-(4-bromophenyl)-N-[(2,4-dimethoxyphenyl)methyl]-1H-pyrazole-4-carboxamide
1-(4-bromophenyl)-N-[(2,4-dimethoxyphenyl)methyl]-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | F434-1000 |
| Compound Name: | 1-(4-bromophenyl)-N-[(2,4-dimethoxyphenyl)methyl]-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 416.27 |
| Molecular Formula: | C19 H18 Br N3 O3 |
| Smiles: | COc1ccc(CNC(c2cnn(c2)c2ccc(cc2)[Br])=O)c(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 3.862 |
| logD: | 3.862 |
| logSw: | -4.028 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.183 |
| InChI Key: | KVMZPHFMFUEBNG-UHFFFAOYSA-N |