[3-(dimethylamino)phenyl]{4-[(1-methyl-1H-indol-3-yl)methyl]piperazin-1-yl}methanone
Chemical Structure Depiction of
[3-(dimethylamino)phenyl]{4-[(1-methyl-1H-indol-3-yl)methyl]piperazin-1-yl}methanone
[3-(dimethylamino)phenyl]{4-[(1-methyl-1H-indol-3-yl)methyl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | F438-0298 |
| Compound Name: | [3-(dimethylamino)phenyl]{4-[(1-methyl-1H-indol-3-yl)methyl]piperazin-1-yl}methanone |
| Molecular Weight: | 376.5 |
| Molecular Formula: | C23 H28 N4 O |
| Smiles: | [H]c1ccc2c(c1)c(CN1CCN(CC1)C(c1cccc(c1)N(C)C)=O)c([H])n2C |
| Stereo: | ACHIRAL |
| logP: | 2.91 |
| logD: | 1.908 |
| logSw: | -3.1301 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 25.7914 |
| InChI Key: | RXPBTIQFTGUINP-UHFFFAOYSA-N |