N~2~-[5-(tert-butylamino)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-yl]-N-[(furan-2-yl)methyl]-N~2~-methylglycinamide
Chemical Structure Depiction of
N~2~-[5-(tert-butylamino)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-yl]-N-[(furan-2-yl)methyl]-N~2~-methylglycinamide
N~2~-[5-(tert-butylamino)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-yl]-N-[(furan-2-yl)methyl]-N~2~-methylglycinamide
Compound characteristics
| Compound ID: | F449-4567 |
| Compound Name: | N~2~-[5-(tert-butylamino)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-yl]-N-[(furan-2-yl)methyl]-N~2~-methylglycinamide |
| Molecular Weight: | 438.55 |
| Molecular Formula: | C22 H26 N6 O2 S |
| Smiles: | CC(C)(C)Nc1c(c2ccccc2)nc2n1nc(N(C)CC(NCc1ccco1)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 4.241 |
| logD: | 4.241 |
| logSw: | -4.2188 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.502 |
| InChI Key: | IHUOCIORMJCZKM-UHFFFAOYSA-N |