1-(3-methoxyphenyl)-4-phenylpiperidine-2,6-dione
Chemical Structure Depiction of
1-(3-methoxyphenyl)-4-phenylpiperidine-2,6-dione
1-(3-methoxyphenyl)-4-phenylpiperidine-2,6-dione
Compound characteristics
| Compound ID: | F452-0106 |
| Compound Name: | 1-(3-methoxyphenyl)-4-phenylpiperidine-2,6-dione |
| Molecular Weight: | 295.34 |
| Molecular Formula: | C18 H17 N O3 |
| Smiles: | COc1cccc(c1)N1C(CC(CC1=O)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6932 |
| logD: | 2.6932 |
| logSw: | -2.9735 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.613 |
| InChI Key: | MORXTMOWZIETQY-UHFFFAOYSA-N |