5-(2-fluorophenyl)-3-hydroxy-1-[(2-methoxyphenyl)methyl]-4-(4-methylphenyl)-1,5-dihydro-2H-pyrrol-2-one
Chemical Structure Depiction of
5-(2-fluorophenyl)-3-hydroxy-1-[(2-methoxyphenyl)methyl]-4-(4-methylphenyl)-1,5-dihydro-2H-pyrrol-2-one
5-(2-fluorophenyl)-3-hydroxy-1-[(2-methoxyphenyl)methyl]-4-(4-methylphenyl)-1,5-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | F455-0119 |
| Compound Name: | 5-(2-fluorophenyl)-3-hydroxy-1-[(2-methoxyphenyl)methyl]-4-(4-methylphenyl)-1,5-dihydro-2H-pyrrol-2-one |
| Molecular Weight: | 403.45 |
| Molecular Formula: | C25 H22 F N O3 |
| Smiles: | Cc1ccc(cc1)C1C(c2ccccc2F)N(Cc2ccccc2OC)C(C=1O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2178 |
| logD: | 5.2172 |
| logSw: | -5.0334 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.719 |
| InChI Key: | JNIUATOLPNEVOV-HSZRJFAPSA-N |