5-(4-chlorophenyl)-3-hydroxy-4-(4-methoxyphenyl)-1-[(3-methoxyphenyl)methyl]-1,5-dihydro-2H-pyrrol-2-one
Chemical Structure Depiction of
5-(4-chlorophenyl)-3-hydroxy-4-(4-methoxyphenyl)-1-[(3-methoxyphenyl)methyl]-1,5-dihydro-2H-pyrrol-2-one
5-(4-chlorophenyl)-3-hydroxy-4-(4-methoxyphenyl)-1-[(3-methoxyphenyl)methyl]-1,5-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | F455-0215 |
| Compound Name: | 5-(4-chlorophenyl)-3-hydroxy-4-(4-methoxyphenyl)-1-[(3-methoxyphenyl)methyl]-1,5-dihydro-2H-pyrrol-2-one |
| Molecular Weight: | 435.91 |
| Molecular Formula: | C25 H22 Cl N O4 |
| Smiles: | COc1ccc(cc1)C1C(c2ccc(cc2)[Cl])N(Cc2cccc(c2)OC)C(C=1O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9537 |
| logD: | 4.9531 |
| logSw: | -5.1199 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.176 |
| InChI Key: | UERNHDFQGRNFGA-HSZRJFAPSA-N |